C14H11F2N3O2S — CID 6736481
N-(1H-benzimidazol-2-ylmethyl)-3,4-difluorobenzenesulfonamide (PubChem CID 6736481) has the molecular formula C14H11F2N3O2S and a molecular weight of 323.32 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 6736481 |
| Molecular Formula | C14H11F2N3O2S |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-3,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1nc2ccccc2[nH]1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11F2N3O2S/c15-10-6-5-9(7-11(10)16)22(20,21)17-8-14-18-12-3-1-2-4-13(12)19-14/h1-7,17H,8H2,(H,18,19) |
| InChIKey | FFTYPFCADQCOFK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |