C24H23FN4O5 — CID 67351410
3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-yl)-5-[2-[(5-fluoro-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-1,3-oxazolidin-2-one (PubChem CID 67351410) has the molecular formula C24H23FN4O5 and a molecular weight of 466.47 g/mol. Its IUPAC name is 3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-yl)-5-[2-[(5-fluoro-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-yl)-5-[2-[(5-fluoro-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67351410 |
| Molecular Formula | C24H23FN4O5 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 3-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-yl)-5-[2-[(5-fluoro-11-oxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methylamino]ethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CCNCC2Cn3c(=O)ccc4ccc(F)c2c43)CN1c1ccc2c(n1)OCCO2 |
| InChI | InChI=1S/C24H23FN4O5/c25-17-3-1-14-2-6-20(30)29-12-15(21(17)22(14)29)11-26-8-7-16-13-28(24(31)34-16)19-5-4-18-23(27-19)33-10-9-32-18/h1-6,15-16,26H,7-13H2 |
| InChIKey | CSFVSXQNHQCKNC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|