C21H24N4O4S — CID 67352514
[3-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclohexyl] acetate (PubChem CID 67352514) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is [3-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclohexyl] acetate.
| Compound Name | [3-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclohexyl] acetate |
|---|---|
| PubChem CID | 67352514 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [3-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclohexyl] acetate |
| SMILES | CC(=O)OC1CCCC(N(c2ccnc3[nH]ccc23)S(=O)(=O)c2cccc(N)c2)C1 |
| InChI | InChI=1S/C21H24N4O4S/c1-14(26)29-17-6-3-5-16(13-17)25(20-9-11-24-21-19(20)8-10-23-21)30(27,28)18-7-2-4-15(22)12-18/h2,4,7-12,16-17H,3,5-6,13,22H2,1H3,(H,23,24) |
| InChIKey | UINHLHFZWMZINM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|