C23H29N5O4S — CID 67345226
tert-butyl N-[3-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclopentyl]carbamate (PubChem CID 67345226) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 67345226 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | tert-butyl N-[3-[(3-aminophenyl)sulfonyl-(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N(c2ccnc3[nH]ccc23)S(=O)(=O)c2cccc(N)c2)C1 |
| InChI | InChI=1S/C23H29N5O4S/c1-23(2,3)32-22(29)27-16-7-8-17(14-16)28(20-10-12-26-21-19(20)9-11-25-21)33(30,31)18-6-4-5-15(24)13-18/h4-6,9-13,16-17H,7-8,14,24H2,1-3H3,(H,25,26)(H,27,29) |
| InChIKey | PAQJCYKSKUGFQO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|