C21H23N5O6S — CID 67344451
tert-butyl 3-[benzenesulfonyl-(5-nitro-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]azetidine-1-carboxylate (PubChem CID 67344451) has the molecular formula C21H23N5O6S and a molecular weight of 473.51 g/mol. Its IUPAC name is tert-butyl 3-[benzenesulfonyl-(5-nitro-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[benzenesulfonyl-(5-nitro-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 67344451 |
| Molecular Formula | C21H23N5O6S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | tert-butyl 3-[benzenesulfonyl-(5-nitro-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N(c2c([N+](=O)[O-])cnc3[nH]ccc23)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H23N5O6S/c1-21(2,3)32-20(27)24-12-14(13-24)25(33(30,31)15-7-5-4-6-8-15)18-16-9-10-22-19(16)23-11-17(18)26(28)29/h4-11,14H,12-13H2,1-3H3,(H,22,23) |
| InChIKey | MTDNCDAKCZFESE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 138.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|