C23H26FN5O6S — CID 67345252
tert-butyl 4-[[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]-3-fluoropiperidine-1-carboxylate (PubChem CID 67345252) has the molecular formula C23H26FN5O6S and a molecular weight of 519.56 g/mol. Its IUPAC name is tert-butyl 4-[[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67345252 |
| Molecular Formula | C23H26FN5O6S |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | tert-butyl 4-[[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2c([N+](=O)[O-])cnc3c2ccn3S(=O)(=O)c2ccccc2)C(F)C1 |
| InChI | InChI=1S/C23H26FN5O6S/c1-23(2,3)35-22(30)27-11-10-18(17(24)14-27)26-20-16-9-12-28(21(16)25-13-19(20)29(31)32)36(33,34)15-7-5-4-6-8-15/h4-9,12-13,17-18H,10-11,14H2,1-3H3,(H,25,26) |
| InChIKey | IEVHBICNSWZALE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|