C26H29N5O4S — CID 155123125
tert-butyl (3aS,6aR)-5-[[1-(benzenesulfonyl)-5-cyanopyrrolo[2,3-b]pyridin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 155123125) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-[[1-(benzenesulfonyl)-5-cyanopyrrolo[2,3-b]pyridin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-[[1-(benzenesulfonyl)-5-cyanopyrrolo[2,3-b]pyridin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155123125 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-[[1-(benzenesulfonyl)-5-cyanopyrrolo[2,3-b]pyridin-4-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(Nc3c(C#N)cnc4c3ccn4S(=O)(=O)c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C26H29N5O4S/c1-26(2,3)35-25(32)30-15-17-11-20(12-18(17)16-30)29-23-19(13-27)14-28-24-22(23)9-10-31(24)36(33,34)21-7-5-4-6-8-21/h4-10,14,17-18,20H,11-12,15-16H2,1-3H3,(H,28,29)/t17-,18+,20? |
| InChIKey | WOWNCCRTWHGNCT-UFRUDQCGSA-N |
| XLogP | 4.20 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |