C22H23N5O2S — CID 155123146
4-[[(3aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-methylamino]-1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine-5-carbonitrile (PubChem CID 155123146) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 4-[[(3aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-methylamino]-1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 4-[[(3aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-methylamino]-1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 155123146 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-[[(3aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-methylamino]-1-(benzenesulfonyl)pyrrolo[2,3-b]pyridine-5-carbonitrile |
| SMILES | CN(c1c(C#N)cnc2c1ccn2S(=O)(=O)c1ccccc1)C1CC2CNC[C@H]2C1 |
| InChI | InChI=1S/C22H23N5O2S/c1-26(18-9-15-12-24-13-16(15)10-18)21-17(11-23)14-25-22-20(21)7-8-27(22)30(28,29)19-5-3-2-4-6-19/h2-8,14-16,18,24H,9-10,12-13H2,1H3/t15-,16?,18?/m1/s1 |
| InChIKey | QOLYTIRQQAMJST-KLHKWILBSA-N |
| XLogP | 2.58 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |