C18H18N4O5S — CID 67345276
(2S)-2-[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]oxan-3-amine (PubChem CID 67345276) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is (2S)-2-[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]oxan-3-amine.
| Compound Name | (2S)-2-[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]oxan-3-amine |
|---|---|
| PubChem CID | 67345276 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (2S)-2-[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]oxan-3-amine |
| SMILES | NC1CCCO[C@H]1c1c([N+](=O)[O-])cnc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N4O5S/c19-14-7-4-10-27-17(14)16-13-8-9-21(18(13)20-11-15(16)22(23)24)28(25,26)12-5-2-1-3-6-12/h1-3,5-6,8-9,11,14,17H,4,7,10,19H2/t14?,17-/m1/s1 |
| InChIKey | GBZBVMOIIGTELJ-FBMWCMRBSA-N |
| XLogP | 2.36 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|