C20H19N3O6S — CID 164943971
methyl 1-[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]cyclopentane-1-carboxylate (PubChem CID 164943971) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is methyl 1-[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 164943971 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | methyl 1-[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(c2c([N+](=O)[O-])cnc3c2ccn3S(=O)(=O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H19N3O6S/c1-29-19(24)20(10-5-6-11-20)17-15-9-12-22(18(15)21-13-16(17)23(25)26)30(27,28)14-7-3-2-4-8-14/h2-4,7-9,12-13H,5-6,10-11H2,1H3 |
| InChIKey | MXGMYPGPYQVNHH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 121.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|