C25H29N5O4S — CID 175699954
1-(benzenesulfonyl)-N-(1-tert-butyl-3-ethyl-2H-azepin-3-yl)-5-nitropyrrolo[2,3-b]pyridin-4-amine (PubChem CID 175699954) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(1-tert-butyl-3-ethyl-2H-azepin-3-yl)-5-nitropyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 1-(benzenesulfonyl)-N-(1-tert-butyl-3-ethyl-2H-azepin-3-yl)-5-nitropyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 175699954 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(1-tert-butyl-3-ethyl-2H-azepin-3-yl)-5-nitropyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CCC1(Nc2c([N+](=O)[O-])cnc3c2ccn3S(=O)(=O)c2ccccc2)C=CC=CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C25H29N5O4S/c1-5-25(14-9-10-15-28(18-25)24(2,3)4)27-22-20-13-16-29(23(20)26-17-21(22)30(31)32)35(33,34)19-11-7-6-8-12-19/h6-17H,5,18H2,1-4H3,(H,26,27) |
| InChIKey | HMZVVTZFASWZIN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|