C25H27N5O5S — CID 164575251
(2R)-2-[benzyl-[[1-(4-methylphenyl)sulfonyl-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]amino]butan-1-ol (PubChem CID 164575251) has the molecular formula C25H27N5O5S and a molecular weight of 509.59 g/mol. Its IUPAC name is (2R)-2-[benzyl-[[1-(4-methylphenyl)sulfonyl-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]amino]butan-1-ol.
| Compound Name | (2R)-2-[benzyl-[[1-(4-methylphenyl)sulfonyl-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]amino]butan-1-ol |
|---|---|
| PubChem CID | 164575251 |
| Molecular Formula | C25H27N5O5S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | (2R)-2-[benzyl-[[1-(4-methylphenyl)sulfonyl-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]amino]butan-1-ol |
| SMILES | CC[C@H](CO)N(Cc1ccccc1)Nc1c([N+](=O)[O-])cnc2c1ccn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H27N5O5S/c1-3-20(17-31)28(16-19-7-5-4-6-8-19)27-24-22-13-14-29(25(22)26-15-23(24)30(32)33)36(34,35)21-11-9-18(2)10-12-21/h4-15,20,31H,3,16-17H2,1-2H3,(H,26,27)/t20-/m1/s1 |
| InChIKey | BDOGLUSTKMGVHI-HXUWFJFHSA-N |
| XLogP | 4.09 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|