C13H12N3O6S- — CID 164910150
4-(1-methoxycarbonylcyclobutyl)-5-nitropyrrolo[2,3-b]pyridine-1-sulfinate (PubChem CID 164910150) has the molecular formula C13H12N3O6S- and a molecular weight of 338.32 g/mol. Its IUPAC name is 4-(1-methoxycarbonylcyclobutyl)-5-nitropyrrolo[2,3-b]pyridine-1-sulfinate.
| Compound Name | 4-(1-methoxycarbonylcyclobutyl)-5-nitropyrrolo[2,3-b]pyridine-1-sulfinate |
|---|---|
| PubChem CID | 164910150 |
| Molecular Formula | C13H12N3O6S- |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-(1-methoxycarbonylcyclobutyl)-5-nitropyrrolo[2,3-b]pyridine-1-sulfinate |
| SMILES | COC(=O)C1(c2c([N+](=O)[O-])cnc3c2ccn3S(=O)[O-])CCC1 |
| InChI | InChI=1S/C13H13N3O6S/c1-22-12(17)13(4-2-5-13)10-8-3-6-15(23(20)21)11(8)14-7-9(10)16(18)19/h3,6-7H,2,4-5H2,1H3,(H,20,21)/p-1 |
| InChIKey | OKVJCBJMTFTXEN-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 127.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|