C21H15BrF2N2O4 — CID 146212116
methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(2-fluorophenyl)cyclobutane-1-carboxylate (PubChem CID 146212116) has the molecular formula C21H15BrF2N2O4 and a molecular weight of 477.26 g/mol. Its IUPAC name is methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(2-fluorophenyl)cyclobutane-1-carboxylate.
| Compound Name | methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(2-fluorophenyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 146212116 |
| Molecular Formula | C21H15BrF2N2O4 |
| Molecular Weight | 477.26 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(2-fluorophenyl)cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(c2c([N+](=O)[O-])cnc3cc(F)c(Br)cc23)CC(c2ccccc2F)C1 |
| InChI | InChI=1S/C21H15BrF2N2O4/c1-30-20(27)21(8-11(9-21)12-4-2-3-5-15(12)23)19-13-6-14(22)16(24)7-17(13)25-10-18(19)26(28)29/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | GXPURCNGFOMJPF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.26 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|