C26H29BrF2N4O5 — CID 175336447
[2-[4-[(6-bromo-7-fluoro-3-nitroquinolin-4-yl)amino]butoxy]-5-fluorophenyl] N-tert-butyl-N-ethylcarbamate (PubChem CID 175336447) has the molecular formula C26H29BrF2N4O5 and a molecular weight of 595.44 g/mol. Its IUPAC name is [2-[4-[(6-bromo-7-fluoro-3-nitroquinolin-4-yl)amino]butoxy]-5-fluorophenyl] N-tert-butyl-N-ethylcarbamate.
| Compound Name | [2-[4-[(6-bromo-7-fluoro-3-nitroquinolin-4-yl)amino]butoxy]-5-fluorophenyl] N-tert-butyl-N-ethylcarbamate |
|---|---|
| PubChem CID | 175336447 |
| Molecular Formula | C26H29BrF2N4O5 |
| Molecular Weight | 595.44 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | [2-[4-[(6-bromo-7-fluoro-3-nitroquinolin-4-yl)amino]butoxy]-5-fluorophenyl] N-tert-butyl-N-ethylcarbamate |
| SMILES | CCN(C(=O)Oc1cc(F)ccc1OCCCCNc1c([N+](=O)[O-])cnc2cc(F)c(Br)cc12)C(C)(C)C |
| InChI | InChI=1S/C26H29BrF2N4O5/c1-5-32(26(2,3)4)25(34)38-23-12-16(28)8-9-22(23)37-11-7-6-10-30-24-17-13-18(27)19(29)14-20(17)31-15-21(24)33(35)36/h8-9,12-15H,5-7,10-11H2,1-4H3,(H,30,31) |
| InChIKey | SJYULAJIQGZAAN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.44 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|