C23H24BrFN4O5 — CID 175001982
[2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]pentoxy]-5-fluorophenyl] N-ethylcarbamate (PubChem CID 175001982) has the molecular formula C23H24BrFN4O5 and a molecular weight of 535.37 g/mol. Its IUPAC name is [2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]pentoxy]-5-fluorophenyl] N-ethylcarbamate.
| Compound Name | [2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]pentoxy]-5-fluorophenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 175001982 |
| Molecular Formula | C23H24BrFN4O5 |
| Molecular Weight | 535.37 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | [2-[4-[(6-bromo-3-nitroquinolin-4-yl)amino]pentoxy]-5-fluorophenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1cc(F)ccc1OCCCC(C)Nc1c([N+](=O)[O-])cnc2ccc(Br)cc12 |
| InChI | InChI=1S/C23H24BrFN4O5/c1-3-26-23(30)34-21-12-16(25)7-9-20(21)33-10-4-5-14(2)28-22-17-11-15(24)6-8-18(17)27-13-19(22)29(31)32/h6-9,11-14H,3-5,10H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | AFXIDWSHHFDKJS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.37 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|