C21H15BrClFN2O4 — CID 165373842
methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(4-chlorophenyl)cyclobutane-1-carboxylate (PubChem CID 165373842) has the molecular formula C21H15BrClFN2O4 and a molecular weight of 493.72 g/mol. Its IUPAC name is methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(4-chlorophenyl)cyclobutane-1-carboxylate.
| Compound Name | methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(4-chlorophenyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 165373842 |
| Molecular Formula | C21H15BrClFN2O4 |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(4-chlorophenyl)cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(c2c([N+](=O)[O-])cnc3cc(F)c(Br)cc23)CC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H15BrClFN2O4/c1-30-20(27)21(8-12(9-21)11-2-4-13(23)5-3-11)19-14-6-15(22)16(24)7-17(14)25-10-18(19)26(28)29/h2-7,10,12H,8-9H2,1H3 |
| InChIKey | LTCYNXHLLLRVPD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|