C21H17BrFN3O5 — CID 165373936
methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(2-methoxy-4-pyridinyl)cyclobutane-1-carboxylate (PubChem CID 165373936) has the molecular formula C21H17BrFN3O5 and a molecular weight of 490.29 g/mol. Its IUPAC name is methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(2-methoxy-4-pyridinyl)cyclobutane-1-carboxylate.
| Compound Name | methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(2-methoxy-4-pyridinyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 165373936 |
| Molecular Formula | C21H17BrFN3O5 |
| Molecular Weight | 490.29 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(2-methoxy-4-pyridinyl)cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(c2c([N+](=O)[O-])cnc3cc(F)c(Br)cc23)CC(c2ccnc(OC)c2)C1 |
| InChI | InChI=1S/C21H17BrFN3O5/c1-30-18-5-11(3-4-24-18)12-8-21(9-12,20(27)31-2)19-13-6-14(22)15(23)7-16(13)25-10-17(19)26(28)29/h3-7,10,12H,8-9H2,1-2H3 |
| InChIKey | XCGCGRBTZNCOJW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 104.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|