C22H18BrFN2O5 — CID 165373848
methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(4-methoxyphenyl)cyclobutane-1-carboxylate (PubChem CID 165373848) has the molecular formula C22H18BrFN2O5 and a molecular weight of 489.30 g/mol. Its IUPAC name is methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(4-methoxyphenyl)cyclobutane-1-carboxylate.
| Compound Name | methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(4-methoxyphenyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 165373848 |
| Molecular Formula | C22H18BrFN2O5 |
| Molecular Weight | 489.30 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | methyl 1-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-3-(4-methoxyphenyl)cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(c2c([N+](=O)[O-])cnc3cc(F)c(Br)cc23)CC(c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C22H18BrFN2O5/c1-30-14-5-3-12(4-6-14)13-9-22(10-13,21(27)31-2)20-15-7-16(23)17(24)8-18(15)25-11-19(20)26(28)29/h3-8,11,13H,9-10H2,1-2H3 |
| InChIKey | UNCGWBMQXFBPEC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|