C24H27NO8 — CID 159144289
methyl 1-(4-methoxy-3-nitrophenyl)cyclopropane-1-carboxylate;methyl 1-(4-methoxyphenyl)cyclopropane-1-carboxylate (PubChem CID 159144289) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is methyl 1-(4-methoxy-3-nitrophenyl)cyclopropane-1-carboxylate;methyl 1-(4-methoxyphenyl)cyclopropane-1-carboxylate.
| Compound Name | methyl 1-(4-methoxy-3-nitrophenyl)cyclopropane-1-carboxylate;methyl 1-(4-methoxyphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 159144289 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | methyl 1-(4-methoxy-3-nitrophenyl)cyclopropane-1-carboxylate;methyl 1-(4-methoxyphenyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(OC)c([N+](=O)[O-])c2)CC1.COC(=O)C1(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C12H13NO5.C12H14O3/c1-17-10-4-3-8(7-9(10)13(15)16)12(5-6-12)11(14)18-2;1-14-10-5-3-9(4-6-10)12(7-8-12)11(13)15-2/h3-4,7H,5-6H2,1-2H3;3-6H,7-8H2,1-2H3 |
| InChIKey | KIMFSUIXYBDPGU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|