C20H13BrF2N2O4 — CID 153353237
[3-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-2-fluorophenyl] cyclobutanecarboxylate (PubChem CID 153353237) has the molecular formula C20H13BrF2N2O4 and a molecular weight of 463.23 g/mol. Its IUPAC name is [3-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-2-fluorophenyl] cyclobutanecarboxylate.
| Compound Name | [3-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-2-fluorophenyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 153353237 |
| Molecular Formula | C20H13BrF2N2O4 |
| Molecular Weight | 463.23 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | [3-(6-bromo-7-fluoro-3-nitroquinolin-4-yl)-2-fluorophenyl] cyclobutanecarboxylate |
| SMILES | O=C(Oc1cccc(-c2c([N+](=O)[O-])cnc3cc(F)c(Br)cc23)c1F)C1CCC1 |
| InChI | InChI=1S/C20H13BrF2N2O4/c21-13-7-12-15(8-14(13)22)24-9-16(25(27)28)18(12)11-5-2-6-17(19(11)23)29-20(26)10-3-1-4-10/h2,5-10H,1,3-4H2 |
| InChIKey | UFEILQSVNJKOHE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|