C37H38Br2FeN6O9 — CID 167665482
tert-butyl 8-bromo-2-oxospiro[3H-pyrrolo[2,3-c]quinoline-1,3'-azetidine]-1'-carboxylate;1-O-tert-butyl 3-O-methyl 3-(6-bromo-3-nitroquinolin-4-yl)azetidine-1,3-dicarboxylate;iron (PubChem CID 167665482) has the molecular formula C37H38Br2FeN6O9 and a molecular weight of 926.40 g/mol. Its IUPAC name is tert-butyl 8-bromo-2-oxospiro[3H-pyrrolo[2,3-c]quinoline-1,3'-azetidine]-1'-carboxylate;1-O-tert-butyl 3-O-methyl 3-(6-bromo-3-nitroquinolin-4-yl)azetidine-1,3-dicarboxylate;iron.
| Compound Name | tert-butyl 8-bromo-2-oxospiro[3H-pyrrolo[2,3-c]quinoline-1,3'-azetidine]-1'-carboxylate;1-O-tert-butyl 3-O-methyl 3-(6-bromo-3-nitroquinolin-4-yl)azetidine-1,3-dicarboxylate;iron |
|---|---|
| PubChem CID | 167665482 |
| Molecular Formula | C37H38Br2FeN6O9 |
| Molecular Weight | 926.40 g/mol |
| Exact Mass | 924.04 |
| IUPAC Name | tert-butyl 8-bromo-2-oxospiro[3H-pyrrolo[2,3-c]quinoline-1,3'-azetidine]-1'-carboxylate;1-O-tert-butyl 3-O-methyl 3-(6-bromo-3-nitroquinolin-4-yl)azetidine-1,3-dicarboxylate;iron |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(=O)Nc1cnc3ccc(Br)cc3c12.COC(=O)C1(c2c([N+](=O)[O-])cnc3ccc(Br)cc23)CN(C(=O)OC(C)(C)C)C1.[Fe] |
| InChI | InChI=1S/C19H20BrN3O6.C18H18BrN3O3.Fe/c1-18(2,3)29-17(25)22-9-19(10-22,16(24)28-4)15-12-7-11(20)5-6-13(12)21-8-14(15)23(26)27;1-17(2,3)25-16(24)22-8-18(9-22)14-11-6-10(19)4-5-12(11)20-7-13(14)21-15(18)23;/h5-8H,9-10H2,1-4H3;4-7H,8-9H2,1-3H3,(H,21,23); |
| InChIKey | SOPZDPWYVUNZDX-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.40 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|