C24H30ClFN2O5S — CID 137481778
tert-butyl 4-[5-(benzenesulfonyl)-2-(2-chloroethoxy)anilino]-3-fluoropiperidine-1-carboxylate (PubChem CID 137481778) has the molecular formula C24H30ClFN2O5S and a molecular weight of 513.03 g/mol. Its IUPAC name is tert-butyl 4-[5-(benzenesulfonyl)-2-(2-chloroethoxy)anilino]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(benzenesulfonyl)-2-(2-chloroethoxy)anilino]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 137481778 |
| Molecular Formula | C24H30ClFN2O5S |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | tert-butyl 4-[5-(benzenesulfonyl)-2-(2-chloroethoxy)anilino]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(S(=O)(=O)c3ccccc3)ccc2OCCCl)C(F)C1 |
| InChI | InChI=1S/C24H30ClFN2O5S/c1-24(2,3)33-23(29)28-13-11-20(19(26)16-28)27-21-15-18(9-10-22(21)32-14-12-25)34(30,31)17-7-5-4-6-8-17/h4-10,15,19-20,27H,11-14,16H2,1-3H3 |
| InChIKey | HUUXMXAOHKTGIJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|