C21H23FN6O6S — CID 172515837
tert-butyl (3R)-3-[[1-(benzenesulfonyl)-5-nitropyrazolo[3,4-b]pyridin-4-yl]amino]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 172515837) has the molecular formula C21H23FN6O6S and a molecular weight of 506.52 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[1-(benzenesulfonyl)-5-nitropyrazolo[3,4-b]pyridin-4-yl]amino]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[1-(benzenesulfonyl)-5-nitropyrazolo[3,4-b]pyridin-4-yl]amino]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172515837 |
| Molecular Formula | C21H23FN6O6S |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | tert-butyl (3R)-3-[[1-(benzenesulfonyl)-5-nitropyrazolo[3,4-b]pyridin-4-yl]amino]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)[C@H](Nc2c([N+](=O)[O-])cnc3c2cnn3S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H23FN6O6S/c1-21(2,3)34-20(29)26-11-15(22)16(12-26)25-18-14-9-24-27(19(14)23-10-17(18)28(30)31)35(32,33)13-7-5-4-6-8-13/h4-10,15-16H,11-12H2,1-3H3,(H,23,25)/t15?,16-/m1/s1 |
| InChIKey | UXSADCMYZPFACR-OEMAIJDKSA-N |
| XLogP | 2.95 |
| TPSA | 149.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|