C22H25N3O5S — CID 22643433
tert-butyl 3-[1-(benzenesulfonyl)indazol-4-yl]oxypyrrolidine-1-carboxylate (PubChem CID 22643433) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is tert-butyl 3-[1-(benzenesulfonyl)indazol-4-yl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(benzenesulfonyl)indazol-4-yl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22643433 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | tert-butyl 3-[1-(benzenesulfonyl)indazol-4-yl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2cccc3c2cnn3S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C22H25N3O5S/c1-22(2,3)30-21(26)24-13-12-16(15-24)29-20-11-7-10-19-18(20)14-23-25(19)31(27,28)17-8-5-4-6-9-17/h4-11,14,16H,12-13,15H2,1-3H3 |
| InChIKey | FXSPSYANAMLEEN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |