C23H21F3N4O5 — CID 67355648
methyl (2S)-3-methyl-2-[[3-[4-[(2,3,4-trifluorophenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carbonyl]amino]butanoate (PubChem CID 67355648) has the molecular formula C23H21F3N4O5 and a molecular weight of 490.44 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[3-[4-[(2,3,4-trifluorophenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carbonyl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[3-[4-[(2,3,4-trifluorophenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 67355648 |
| Molecular Formula | C23H21F3N4O5 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[3-[4-[(2,3,4-trifluorophenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carbonyl]amino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1cc(-c2ccc(NC(=O)Nc3ccc(F)c(F)c3F)cc2)no1)C(C)C |
| InChI | InChI=1S/C23H21F3N4O5/c1-11(2)20(22(32)34-3)29-21(31)17-10-16(30-35-17)12-4-6-13(7-5-12)27-23(33)28-15-9-8-14(24)18(25)19(15)26/h4-11,20H,1-3H3,(H,29,31)(H2,27,28,33)/t20-/m0/s1 |
| InChIKey | KNKNLDDOVLJFEI-FQEVSTJZSA-N |
| XLogP | 4.33 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|