C24H26N4O4S — CID 91394008
methyl 3-methyl-2-[[3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carbothioyl]amino]butanoate (PubChem CID 91394008) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is methyl 3-methyl-2-[[3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carbothioyl]amino]butanoate.
| Compound Name | methyl 3-methyl-2-[[3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carbothioyl]amino]butanoate |
|---|---|
| PubChem CID | 91394008 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | methyl 3-methyl-2-[[3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carbothioyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=S)c1cc(-c2ccc(NC(=O)Nc3ccc(C)cc3)cc2)no1)C(C)C |
| InChI | InChI=1S/C24H26N4O4S/c1-14(2)21(23(29)31-4)27-22(33)20-13-19(28-32-20)16-7-11-18(12-8-16)26-24(30)25-17-9-5-15(3)6-10-17/h5-14,21H,1-4H3,(H,27,33)(H2,25,26,30) |
| InChIKey | SEHNNVBXFORXRP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|