C19H21N3O3 — CID 6735800
4-(dimethylamino)-N-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)benzamide (PubChem CID 6735800) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)benzamide.
| Compound Name | 4-(dimethylamino)-N-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)benzamide |
|---|---|
| PubChem CID | 6735800 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-(dimethylamino)-N-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)benzamide |
| SMILES | CN(C)c1ccc(C(=O)NN2C(=O)C3C4C=CC(CC4)C3C2=O)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-21(2)14-9-7-13(8-10-14)17(23)20-22-18(24)15-11-3-4-12(6-5-11)16(15)19(22)25/h3-4,7-12,15-16H,5-6H2,1-2H3,(H,20,23) |
| InChIKey | UJFODFLQLYZDJC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|