C21H24N2O3 — CID 6735840
4-tert-butyl-N-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)benzamide (PubChem CID 6735840) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-tert-butyl-N-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)benzamide |
|---|---|
| PubChem CID | 6735840 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-tert-butyl-N-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NN2C(=O)C3C4C=CC(CC4)C3C2=O)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-21(2,3)15-10-8-14(9-11-15)18(24)22-23-19(25)16-12-4-5-13(7-6-12)17(16)20(23)26/h4-5,8-13,16-17H,6-7H2,1-3H3,(H,22,24) |
| InChIKey | LVWPPYFYYVDLAI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|