C20H22N6O — CID 67361007
[1-methyl-3-(2-phenylpyrimidin-5-yl)pyrazol-5-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 67361007) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is [1-methyl-3-(2-phenylpyrimidin-5-yl)pyrazol-5-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [1-methyl-3-(2-phenylpyrimidin-5-yl)pyrazol-5-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 67361007 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [1-methyl-3-(2-phenylpyrimidin-5-yl)pyrazol-5-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cc(-c3cnc(-c4ccccc4)nc3)nn2C)CC1 |
| InChI | InChI=1S/C20H22N6O/c1-24-8-10-26(11-9-24)20(27)18-12-17(23-25(18)2)16-13-21-19(22-14-16)15-6-4-3-5-7-15/h3-7,12-14H,8-11H2,1-2H3 |
| InChIKey | SVRWTJCXWQADCV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |