C23H21N5O4S2 — CID 67361193
N-methyl-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]benzenesulfonamide (PubChem CID 67361193) has the molecular formula C23H21N5O4S2 and a molecular weight of 495.59 g/mol. Its IUPAC name is N-methyl-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]benzenesulfonamide.
| Compound Name | N-methyl-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67361193 |
| Molecular Formula | C23H21N5O4S2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N-methyl-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(-c2cc3c4c(cnc3n2S(=O)(=O)c2ccc(C)cc2)cnn4C)c1 |
| InChI | InChI=1S/C23H21N5O4S2/c1-15-7-9-18(10-8-15)34(31,32)28-21(16-5-4-6-19(11-16)33(29,30)24-2)12-20-22-17(13-25-23(20)28)14-26-27(22)3/h4-14,24H,1-3H3 |
| InChIKey | LUEKLTBUAWMYNB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |