About thiadiazol-4-yl N-phenylcarbamate
thiadiazol-4-yl N-phenylcarbamate (PubChem CID 67362884) has the molecular formula C9H7N3O2S
and a molecular weight of 221.24 g/mol. Its IUPAC name is thiadiazol-4-yl N-phenylcarbamate.
Molecular Properties
| Compound Name | thiadiazol-4-yl N-phenylcarbamate |
| PubChem CID | 67362884 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | thiadiazol-4-yl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)Oc1csnn1 |
| InChI | InChI=1S/C9H7N3O2S/c13-9(14-8-6-15-12-11-8)10-7-4-2-1-3-5-7/h1-6H,(H,10,13) |
| InChIKey | FHDHOYKCGBUIPX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze thiadiazol-4-yl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiadiazol-4-yl N-phenylcarbamate?
The IUPAC name of thiadiazol-4-yl N-phenylcarbamate (CID 67362884) is thiadiazol-4-yl N-phenylcarbamate.
What is the SMILES notation for thiadiazol-4-yl N-phenylcarbamate?
The canonical SMILES for thiadiazol-4-yl N-phenylcarbamate is O=C(Nc1ccccc1)Oc1csnn1.
What is the InChIKey of thiadiazol-4-yl N-phenylcarbamate?
The InChIKey is FHDHOYKCGBUIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2S/c13-9(14-8-6-15-12-11-8)10-7-4-2-1-3-5-7/h1-6H,(H,10,13).
What are the key properties of thiadiazol-4-yl N-phenylcarbamate?
thiadiazol-4-yl N-phenylcarbamate has a molecular weight of 221.24 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiadiazol-4-yl N-phenylcarbamate is sourced from PubChem (CID 67362884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).