About 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid
2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid (PubChem CID 67362986) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid |
| PubChem CID | 67362986 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid |
| SMILES | CCC(C(=O)O)C1=CCN(C)CC1 |
| InChI | InChI=1S/C10H17NO2/c1-3-9(10(12)13)8-4-6-11(2)7-5-8/h4,9H,3,5-7H2,1-2H3,(H,12,13) |
| InChIKey | ARWAJIXPXQIADD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid?
The IUPAC name of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid (CID 67362986) is 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid.
What is the SMILES notation for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid?
The canonical SMILES for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid is CCC(C(=O)O)C1=CCN(C)CC1.
What is the InChIKey of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid?
The InChIKey is ARWAJIXPXQIADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-3-9(10(12)13)8-4-6-11(2)7-5-8/h4,9H,3,5-7H2,1-2H3,(H,12,13).
What are the key properties of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid?
2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid has a molecular weight of 183.25 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)butanoic acid is sourced from PubChem (CID 67362986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).