C30H28N2O3 — CID 67363612
methyl 6-(3-naphthalen-2-yl-2-phenylbenzimidazol-5-yl)oxyhexanoate (PubChem CID 67363612) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is methyl 6-(3-naphthalen-2-yl-2-phenylbenzimidazol-5-yl)oxyhexanoate.
| Compound Name | methyl 6-(3-naphthalen-2-yl-2-phenylbenzimidazol-5-yl)oxyhexanoate |
|---|---|
| PubChem CID | 67363612 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methyl 6-(3-naphthalen-2-yl-2-phenylbenzimidazol-5-yl)oxyhexanoate |
| SMILES | COC(=O)CCCCCOc1ccc2nc(-c3ccccc3)n(-c3ccc4ccccc4c3)c2c1 |
| InChI | InChI=1S/C30H28N2O3/c1-34-29(33)14-6-3-9-19-35-26-17-18-27-28(21-26)32(30(31-27)23-11-4-2-5-12-23)25-16-15-22-10-7-8-13-24(22)20-25/h2,4-5,7-8,10-13,15-18,20-21H,3,6,9,14,19H2,1H3 |
| InChIKey | ZAEMYEUMUSPFSG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|