C18H25N3O — CID 67363673
3,3,4-trimethyl-1-[(quinazolin-2-ylamino)methyl]cyclohexan-1-ol (PubChem CID 67363673) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 3,3,4-trimethyl-1-[(quinazolin-2-ylamino)methyl]cyclohexan-1-ol.
| Compound Name | 3,3,4-trimethyl-1-[(quinazolin-2-ylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 67363673 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 3,3,4-trimethyl-1-[(quinazolin-2-ylamino)methyl]cyclohexan-1-ol |
| SMILES | CC1CCC(O)(CNc2ncc3ccccc3n2)CC1(C)C |
| InChI | InChI=1S/C18H25N3O/c1-13-8-9-18(22,11-17(13,2)3)12-20-16-19-10-14-6-4-5-7-15(14)21-16/h4-7,10,13,22H,8-9,11-12H2,1-3H3,(H,19,20,21) |
| InChIKey | RFXPOTWMGHBBPB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |