C16H13F3N2O5 — CID 6736418
[5-[[[4-(trifluoromethoxy)benzoyl]hydrazinylidene]methyl]furan-2-yl]methyl acetate (PubChem CID 6736418) has the molecular formula C16H13F3N2O5 and a molecular weight of 370.28 g/mol. Its IUPAC name is [5-[[[4-(trifluoromethoxy)benzoyl]hydrazinylidene]methyl]furan-2-yl]methyl acetate.
| Compound Name | [5-[[[4-(trifluoromethoxy)benzoyl]hydrazinylidene]methyl]furan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 6736418 |
| Molecular Formula | C16H13F3N2O5 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [5-[[[4-(trifluoromethoxy)benzoyl]hydrazinylidene]methyl]furan-2-yl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(C=NNC(=O)c2ccc(OC(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C16H13F3N2O5/c1-10(22)24-9-14-7-6-13(25-14)8-20-21-15(23)11-2-4-12(5-3-11)26-16(17,18)19/h2-8H,9H2,1H3,(H,21,23) |
| InChIKey | QWSHQKFYBFKNBC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|