C14H20N4O2S — CID 6736499
2-cyano-N-(1,2-diethylpyrazolidin-4-yl)benzenesulfonamide (PubChem CID 6736499) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-cyano-N-(1,2-diethylpyrazolidin-4-yl)benzenesulfonamide.
| Compound Name | 2-cyano-N-(1,2-diethylpyrazolidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 6736499 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-cyano-N-(1,2-diethylpyrazolidin-4-yl)benzenesulfonamide |
| SMILES | CCN1CC(NS(=O)(=O)c2ccccc2C#N)CN1CC |
| InChI | InChI=1S/C14H20N4O2S/c1-3-17-10-13(11-18(17)4-2)16-21(19,20)14-8-6-5-7-12(14)9-15/h5-8,13,16H,3-4,10-11H2,1-2H3 |
| InChIKey | WYVGSYSXWYZTKE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |