C16H14N2O2S — CID 3592960
2-cyano-N-(2,3-dihydro-1H-inden-2-yl)benzenesulfonamide (PubChem CID 3592960) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dihydro-1H-inden-2-yl)benzenesulfonamide.
| Compound Name | 2-cyano-N-(2,3-dihydro-1H-inden-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3592960 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-cyano-N-(2,3-dihydro-1H-inden-2-yl)benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H14N2O2S/c17-11-14-7-3-4-8-16(14)21(19,20)18-15-9-12-5-1-2-6-13(12)10-15/h1-8,15,18H,9-10H2 |
| InChIKey | AMCCBGWRYVLLBK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |