C21H33N7O2 — CID 67365365
2,6-diaminohexanoic acid;N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine (PubChem CID 67365365) has the molecular formula C21H33N7O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine.
| Compound Name | 2,6-diaminohexanoic acid;N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 67365365 |
| Molecular Formula | C21H33N7O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 2,6-diaminohexanoic acid;N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine |
| SMILES | CN(C)CCc1c[nH]c2ccc(Cn3cncn3)cc12.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C15H19N5.C6H14N2O2/c1-19(2)6-5-13-8-17-15-4-3-12(7-14(13)15)9-20-11-16-10-18-20;7-4-2-1-3-5(8)6(9)10/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3;5H,1-4,7-8H2,(H,9,10) |
| InChIKey | CAZNWNJXQUHTDP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|