C15H19N5O — CID 91381656
2-[1-hydroxy-5-(1,2,4-triazol-1-ylmethyl)indol-3-yl]-N,N-dimethylethanamine (PubChem CID 91381656) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-[1-hydroxy-5-(1,2,4-triazol-1-ylmethyl)indol-3-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[1-hydroxy-5-(1,2,4-triazol-1-ylmethyl)indol-3-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 91381656 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-[1-hydroxy-5-(1,2,4-triazol-1-ylmethyl)indol-3-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1cn(O)c2ccc(Cn3cncn3)cc12 |
| InChI | InChI=1S/C15H19N5O/c1-18(2)6-5-13-9-20(21)15-4-3-12(7-14(13)15)8-19-11-16-10-17-19/h3-4,7,9-11,21H,5-6,8H2,1-2H3 |
| InChIKey | OWIIREMYGKEWFW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|