C16H22ClN5 — CID 44820020
trimethyl-[2-[5-(1,2,4-triazol-1-ylmethyl)indol-1-id-3-yl]ethyl]azanium;hydrochloride (PubChem CID 44820020) has the molecular formula C16H22ClN5 and a molecular weight of 319.84 g/mol. Its IUPAC name is trimethyl-[2-[5-(1,2,4-triazol-1-ylmethyl)indol-1-id-3-yl]ethyl]azanium;hydrochloride.
| Compound Name | trimethyl-[2-[5-(1,2,4-triazol-1-ylmethyl)indol-1-id-3-yl]ethyl]azanium;hydrochloride |
|---|---|
| PubChem CID | 44820020 |
| Molecular Formula | C16H22ClN5 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | trimethyl-[2-[5-(1,2,4-triazol-1-ylmethyl)indol-1-id-3-yl]ethyl]azanium;hydrochloride |
| SMILES | C[N+](C)(C)CCc1c[n-]c2ccc(Cn3cncn3)cc12.Cl |
| InChI | InChI=1S/C16H21N5.ClH/c1-21(2,3)7-6-14-9-18-16-5-4-13(8-15(14)16)10-20-12-17-11-19-20;/h4-5,8-9,11-12H,6-7,10H2,1-3H3;1H |
| InChIKey | HTKPMEOKFUWXBA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|