About [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate
[1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate (PubChem CID 6736865) has the molecular formula C23H24Cl2N2O2S
and a molecular weight of 463.43 g/mol. Its IUPAC name is [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate.
Molecular Properties
| Compound Name | [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate |
| PubChem CID | 6736865 |
| Molecular Formula | C23H24Cl2N2O2S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate |
| SMILES | O=C(NCc1csc2ccccc12)OCC1CCCCN1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H24Cl2N2O2S/c24-20-8-5-9-21(25)19(20)13-27-11-4-3-6-17(27)14-29-23(28)26-12-16-15-30-22-10-2-1-7-18(16)22/h1-2,5,7-10,15,17H,3-4,6,11-14H2,(H,26,28) |
| InChIKey | LISIOUJLQSLMQY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate?
The IUPAC name of [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate (CID 6736865) is [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate.
What is the SMILES notation for [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate?
The canonical SMILES for [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate is O=C(NCc1csc2ccccc12)OCC1CCCCN1Cc1c(Cl)cccc1Cl.
What is the InChIKey of [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate?
The InChIKey is LISIOUJLQSLMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24Cl2N2O2S/c24-20-8-5-9-21(25)19(20)13-27-11-4-3-6-17(27)14-29-23(28)26-12-16-15-30-22-10-2-1-7-18(16)22/h1-2,5,7-10,15,17H,3-4,6,11-14H2,(H,26,28).
What are the key properties of [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate?
[1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate has a molecular weight of 463.43 g/mol, XLogP of 6.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2,6-dichlorophenyl)methyl]piperidin-2-yl]methyl N-(1-benzothiophen-3-ylmethyl)carbamate is sourced from PubChem (CID 6736865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).