C13H20O2 — CID 67370361
1-[1-(methoxymethyl)cyclopenta-2,4-dien-1-yl]hexan-1-one (PubChem CID 67370361) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)cyclopenta-2,4-dien-1-yl]hexan-1-one.
| Compound Name | 1-[1-(methoxymethyl)cyclopenta-2,4-dien-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 67370361 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-[1-(methoxymethyl)cyclopenta-2,4-dien-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)C1(COC)C=CC=C1 |
| InChI | InChI=1S/C13H20O2/c1-3-4-5-8-12(14)13(11-15-2)9-6-7-10-13/h6-7,9-10H,3-5,8,11H2,1-2H3 |
| InChIKey | OKDGSTFDBGMKGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|