C31H44Cl2N4O2 — CID 67373980
3,4-dichloro-N-[[(3S,5S)-3-[2-[methyl(pentyl)amino]ethyl]-2-oxo-1-(2-phenylbutyl)-1,4-diazepan-5-yl]methyl]benzamide (PubChem CID 67373980) has the molecular formula C31H44Cl2N4O2 and a molecular weight of 575.63 g/mol. Its IUPAC name is 3,4-dichloro-N-[[(3S,5S)-3-[2-[methyl(pentyl)amino]ethyl]-2-oxo-1-(2-phenylbutyl)-1,4-diazepan-5-yl]methyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[(3S,5S)-3-[2-[methyl(pentyl)amino]ethyl]-2-oxo-1-(2-phenylbutyl)-1,4-diazepan-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 67373980 |
| Molecular Formula | C31H44Cl2N4O2 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 3,4-dichloro-N-[[(3S,5S)-3-[2-[methyl(pentyl)amino]ethyl]-2-oxo-1-(2-phenylbutyl)-1,4-diazepan-5-yl]methyl]benzamide |
| SMILES | CCCCCN(C)CC[C@@H]1N[C@H](CNC(=O)c2ccc(Cl)c(Cl)c2)CCN(CC(CC)c2ccccc2)C1=O |
| InChI | InChI=1S/C31H44Cl2N4O2/c1-4-6-10-17-36(3)18-16-29-31(39)37(22-23(5-2)24-11-8-7-9-12-24)19-15-26(35-29)21-34-30(38)25-13-14-27(32)28(33)20-25/h7-9,11-14,20,23,26,29,35H,4-6,10,15-19,21-22H2,1-3H3,(H,34,38)/t23?,26-,29-/m0/s1 |
| InChIKey | AOBVCTOCMJRLRQ-AEZKEOSBSA-N |
| XLogP | 5.99 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|