C29H37ClF3IN4O2 — CID 89330549
4-chloro-3-(iodomethyl)-N-[[(3S,5S)-2-oxo-1-[(2S)-2-phenylbutyl]-3-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]-1,4-diazepan-5-yl]methyl]benzamide (PubChem CID 89330549) has the molecular formula C29H37ClF3IN4O2 and a molecular weight of 692.99 g/mol. Its IUPAC name is 4-chloro-3-(iodomethyl)-N-[[(3S,5S)-2-oxo-1-[(2S)-2-phenylbutyl]-3-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]-1,4-diazepan-5-yl]methyl]benzamide.
| Compound Name | 4-chloro-3-(iodomethyl)-N-[[(3S,5S)-2-oxo-1-[(2S)-2-phenylbutyl]-3-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]-1,4-diazepan-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 89330549 |
| Molecular Formula | C29H37ClF3IN4O2 |
| Molecular Weight | 692.99 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | 4-chloro-3-(iodomethyl)-N-[[(3S,5S)-2-oxo-1-[(2S)-2-phenylbutyl]-3-[2-(1,1,1-trifluoropropan-2-ylamino)ethyl]-1,4-diazepan-5-yl]methyl]benzamide |
| SMILES | CC[C@H](CN1CC[C@@H](CNC(=O)c2ccc(Cl)c(CI)c2)N[C@@H](CCNC(C)C(F)(F)F)C1=O)c1ccccc1 |
| InChI | InChI=1S/C29H37ClF3IN4O2/c1-3-20(21-7-5-4-6-8-21)18-38-14-12-24(17-36-27(39)22-9-10-25(30)23(15-22)16-34)37-26(28(38)40)11-13-35-19(2)29(31,32)33/h4-10,15,19-20,24,26,35,37H,3,11-14,16-18H2,1-2H3,(H,36,39)/t19?,20-,24+,26+/m1/s1 |
| InChIKey | JKDYZDBNJCMIDQ-UUPGCKIPSA-N |
| XLogP | 5.69 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.99 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|