C28H44ClIN4O2 — CID 89330561
4-chloro-N-[[(3S,5S)-1-[(3,5-dimethylcyclohexyl)methyl]-2-oxo-3-[2-(propan-2-ylamino)ethyl]-1,4-diazepan-5-yl]methyl]-3-(iodomethyl)benzamide (PubChem CID 89330561) has the molecular formula C28H44ClIN4O2 and a molecular weight of 631.04 g/mol. Its IUPAC name is 4-chloro-N-[[(3S,5S)-1-[(3,5-dimethylcyclohexyl)methyl]-2-oxo-3-[2-(propan-2-ylamino)ethyl]-1,4-diazepan-5-yl]methyl]-3-(iodomethyl)benzamide.
| Compound Name | 4-chloro-N-[[(3S,5S)-1-[(3,5-dimethylcyclohexyl)methyl]-2-oxo-3-[2-(propan-2-ylamino)ethyl]-1,4-diazepan-5-yl]methyl]-3-(iodomethyl)benzamide |
|---|---|
| PubChem CID | 89330561 |
| Molecular Formula | C28H44ClIN4O2 |
| Molecular Weight | 631.04 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 4-chloro-N-[[(3S,5S)-1-[(3,5-dimethylcyclohexyl)methyl]-2-oxo-3-[2-(propan-2-ylamino)ethyl]-1,4-diazepan-5-yl]methyl]-3-(iodomethyl)benzamide |
| SMILES | CC1CC(C)CC(CN2CC[C@@H](CNC(=O)c3ccc(Cl)c(CI)c3)N[C@@H](CCNC(C)C)C2=O)C1 |
| InChI | InChI=1S/C28H44ClIN4O2/c1-18(2)31-9-7-26-28(36)34(17-21-12-19(3)11-20(4)13-21)10-8-24(33-26)16-32-27(35)22-5-6-25(29)23(14-22)15-30/h5-6,14,18-21,24,26,31,33H,7-13,15-17H2,1-4H3,(H,32,35)/t19?,20?,21?,24-,26-/m0/s1 |
| InChIKey | HSLOEJHJJMPFRJ-KCBDBYEYSA-N |
| XLogP | 5.02 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.04 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|