C21H32ClIN4O2 — CID 70969003
N-[[(3S,5S)-3-(2-aminoethyl)-1-(2-ethylbutyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-chloro-4-iodobenzamide (PubChem CID 70969003) has the molecular formula C21H32ClIN4O2 and a molecular weight of 534.87 g/mol. Its IUPAC name is N-[[(3S,5S)-3-(2-aminoethyl)-1-(2-ethylbutyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-chloro-4-iodobenzamide.
| Compound Name | N-[[(3S,5S)-3-(2-aminoethyl)-1-(2-ethylbutyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-chloro-4-iodobenzamide |
|---|---|
| PubChem CID | 70969003 |
| Molecular Formula | C21H32ClIN4O2 |
| Molecular Weight | 534.87 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | N-[[(3S,5S)-3-(2-aminoethyl)-1-(2-ethylbutyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-chloro-4-iodobenzamide |
| SMILES | CCC(CC)CN1CC[C@@H](CNC(=O)c2ccc(I)c(Cl)c2)N[C@@H](CCN)C1=O |
| InChI | InChI=1S/C21H32ClIN4O2/c1-3-14(4-2)13-27-10-8-16(26-19(7-9-24)21(27)29)12-25-20(28)15-5-6-18(23)17(22)11-15/h5-6,11,14,16,19,26H,3-4,7-10,12-13,24H2,1-2H3,(H,25,28)/t16-,19-/m0/s1 |
| InChIKey | SUCFBNPSHBXXST-LPHOPBHVSA-N |
| XLogP | 3.02 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|