C34H33N3O3 — CID 6737417
[2-[[1-[(9-ethylcarbazol-3-yl)methyl]pyrrolidin-3-yl]carbamoyl]phenyl]methyl benzoate (PubChem CID 6737417) has the molecular formula C34H33N3O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is [2-[[1-[(9-ethylcarbazol-3-yl)methyl]pyrrolidin-3-yl]carbamoyl]phenyl]methyl benzoate.
| Compound Name | [2-[[1-[(9-ethylcarbazol-3-yl)methyl]pyrrolidin-3-yl]carbamoyl]phenyl]methyl benzoate |
|---|---|
| PubChem CID | 6737417 |
| Molecular Formula | C34H33N3O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | [2-[[1-[(9-ethylcarbazol-3-yl)methyl]pyrrolidin-3-yl]carbamoyl]phenyl]methyl benzoate |
| SMILES | CCn1c2ccccc2c2cc(CN3CCC(NC(=O)c4ccccc4COC(=O)c4ccccc4)C3)ccc21 |
| InChI | InChI=1S/C34H33N3O3/c1-2-37-31-15-9-8-14-29(31)30-20-24(16-17-32(30)37)21-36-19-18-27(22-36)35-33(38)28-13-7-6-12-26(28)23-40-34(39)25-10-4-3-5-11-25/h3-17,20,27H,2,18-19,21-23H2,1H3,(H,35,38) |
| InChIKey | UNFSAMFMKWTDDF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |