C28H30N4O5 — CID 6733849
(3-methoxy-4-nitrophenyl)methyl N-[1-[(9-ethylcarbazol-3-yl)methyl]pyrrolidin-3-yl]carbamate (PubChem CID 6733849) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is (3-methoxy-4-nitrophenyl)methyl N-[1-[(9-ethylcarbazol-3-yl)methyl]pyrrolidin-3-yl]carbamate.
| Compound Name | (3-methoxy-4-nitrophenyl)methyl N-[1-[(9-ethylcarbazol-3-yl)methyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6733849 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (3-methoxy-4-nitrophenyl)methyl N-[1-[(9-ethylcarbazol-3-yl)methyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCn1c2ccccc2c2cc(CN3CCC(NC(=O)OCc4ccc([N+](=O)[O-])c(OC)c4)C3)ccc21 |
| InChI | InChI=1S/C28H30N4O5/c1-3-31-24-7-5-4-6-22(24)23-14-19(8-10-25(23)31)16-30-13-12-21(17-30)29-28(33)37-18-20-9-11-26(32(34)35)27(15-20)36-2/h4-11,14-15,21H,3,12-13,16-18H2,1-2H3,(H,29,33) |
| InChIKey | OAPVWKZLTPQQOM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|