C11H20N2O — CID 67376588
1-[5-methyl-2-(2-methylpropyl)pyrazol-3-yl]propan-1-ol (PubChem CID 67376588) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[5-methyl-2-(2-methylpropyl)pyrazol-3-yl]propan-1-ol.
| Compound Name | 1-[5-methyl-2-(2-methylpropyl)pyrazol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 67376588 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-[5-methyl-2-(2-methylpropyl)pyrazol-3-yl]propan-1-ol |
| SMILES | CCC(O)c1cc(C)nn1CC(C)C |
| InChI | InChI=1S/C11H20N2O/c1-5-11(14)10-6-9(4)12-13(10)7-8(2)3/h6,8,11,14H,5,7H2,1-4H3 |
| InChIKey | GPRHMCDPIUUDSL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |